C29H31NO5 — CID 66842222
16,17-dimethoxy-21-[2-(4-methoxyphenyl)ethyl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene (PubChem CID 66842222) has the molecular formula C29H31NO5 and a molecular weight of 473.57 g/mol. Its IUPAC name is 16,17-dimethoxy-21-[2-(4-methoxyphenyl)ethyl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene.
| Compound Name | 16,17-dimethoxy-21-[2-(4-methoxyphenyl)ethyl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene |
|---|---|
| PubChem CID | 66842222 |
| Molecular Formula | C29H31NO5 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 16,17-dimethoxy-21-[2-(4-methoxyphenyl)ethyl]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene |
| SMILES | COc1ccc(CCC2c3ccc(OC)c(OC)c3CN3CCc4cc5c(cc4C23)OCO5)cc1 |
| InChI | InChI=1S/C29H31NO5/c1-31-20-7-4-18(5-8-20)6-9-22-21-10-11-25(32-2)29(33-3)24(21)16-30-13-12-19-14-26-27(35-17-34-26)15-23(19)28(22)30/h4-5,7-8,10-11,14-15,22,28H,6,9,12-13,16-17H2,1-3H3 |
| InChIKey | FXWMZRLJLMTUAL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |