C22H27NO6 — CID 23257561
(2R,3R)-7,8-dimethoxy-3,11-dimethyl-17,19-dioxa-11-azatetracyclo[12.7.0.04,9.016,20]henicosa-1(21),4(9),5,7,14,16(20)-hexaene-2,3-diol (PubChem CID 23257561) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is (2R,3R)-7,8-dimethoxy-3,11-dimethyl-17,19-dioxa-11-azatetracyclo[12.7.0.04,9.016,20]henicosa-1(21),4(9),5,7,14,16(20)-hexaene-2,3-diol.
| Compound Name | (2R,3R)-7,8-dimethoxy-3,11-dimethyl-17,19-dioxa-11-azatetracyclo[12.7.0.04,9.016,20]henicosa-1(21),4(9),5,7,14,16(20)-hexaene-2,3-diol |
|---|---|
| PubChem CID | 23257561 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | (2R,3R)-7,8-dimethoxy-3,11-dimethyl-17,19-dioxa-11-azatetracyclo[12.7.0.04,9.016,20]henicosa-1(21),4(9),5,7,14,16(20)-hexaene-2,3-diol |
| SMILES | COc1ccc2c(c1OC)CN(C)CCc1cc3c(cc1[C@@H](O)[C@]2(C)O)OCO3 |
| InChI | InChI=1S/C22H27NO6/c1-22(25)16-5-6-17(26-3)20(27-4)15(16)11-23(2)8-7-13-9-18-19(29-12-28-18)10-14(13)21(22)24/h5-6,9-10,21,24-25H,7-8,11-12H2,1-4H3/t21-,22-/m1/s1 |
| InChIKey | ZTMVDVQBOKNLGH-FGZHOGPDSA-N |
| XLogP | 2.36 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |