C21H25NO9S — CID 25210836
7,8-dimethoxy-11-methyl-17,19-dioxa-11-azatetracyclo[12.7.0.04,9.016,20]henicosa-1(21),4(9),5,7,14,16(20)-hexaen-2-one;sulfuric acid (PubChem CID 25210836) has the molecular formula C21H25NO9S and a molecular weight of 467.50 g/mol. Its IUPAC name is 7,8-dimethoxy-11-methyl-17,19-dioxa-11-azatetracyclo[12.7.0.04,9.016,20]henicosa-1(21),4(9),5,7,14,16(20)-hexaen-2-one;sulfuric acid.
| Compound Name | 7,8-dimethoxy-11-methyl-17,19-dioxa-11-azatetracyclo[12.7.0.04,9.016,20]henicosa-1(21),4(9),5,7,14,16(20)-hexaen-2-one;sulfuric acid |
|---|---|
| PubChem CID | 25210836 |
| Molecular Formula | C21H25NO9S |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 7,8-dimethoxy-11-methyl-17,19-dioxa-11-azatetracyclo[12.7.0.04,9.016,20]henicosa-1(21),4(9),5,7,14,16(20)-hexaen-2-one;sulfuric acid |
| SMILES | COc1ccc2c(c1OC)CN(C)CCc1cc3c(cc1C(=O)C2)OCO3.O=S(=O)(O)O |
| InChI | InChI=1S/C21H23NO5.H2O4S/c1-22-7-6-14-9-19-20(27-12-26-19)10-15(14)17(23)8-13-4-5-18(24-2)21(25-3)16(13)11-22;1-5(2,3)4/h4-5,9-10H,6-8,11-12H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | BERMQGHCGFPUNV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|