C20H17NO7 — CID 15089360
1-hydroxy-16,17-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene-14,21-dione (PubChem CID 15089360) has the molecular formula C20H17NO7 and a molecular weight of 383.36 g/mol. Its IUPAC name is 1-hydroxy-16,17-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene-14,21-dione.
| Compound Name | 1-hydroxy-16,17-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene-14,21-dione |
|---|---|
| PubChem CID | 15089360 |
| Molecular Formula | C20H17NO7 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 1-hydroxy-16,17-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene-14,21-dione |
| SMILES | COc1ccc2c(c1OC)C(=O)N1CCc3cc4c(cc3C1(O)C2=O)OCO4 |
| InChI | InChI=1S/C20H17NO7/c1-25-13-4-3-11-16(17(13)26-2)19(23)21-6-5-10-7-14-15(28-9-27-14)8-12(10)20(21,24)18(11)22/h3-4,7-8,24H,5-6,9H2,1-2H3 |
| InChIKey | HRYVMUYQGLFXRE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |