C24H25NO6 — CID 102238610
21-hydroxy-16,17-dimethoxy-21-methyl-5,7-dioxa-13-azahexacyclo[12.7.3.01,13.02,10.04,8.015,20]tetracosa-2,4(8),9,15(20),16,18-hexaen-23-one (PubChem CID 102238610) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is 21-hydroxy-16,17-dimethoxy-21-methyl-5,7-dioxa-13-azahexacyclo[12.7.3.01,13.02,10.04,8.015,20]tetracosa-2,4(8),9,15(20),16,18-hexaen-23-one.
| Compound Name | 21-hydroxy-16,17-dimethoxy-21-methyl-5,7-dioxa-13-azahexacyclo[12.7.3.01,13.02,10.04,8.015,20]tetracosa-2,4(8),9,15(20),16,18-hexaen-23-one |
|---|---|
| PubChem CID | 102238610 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 21-hydroxy-16,17-dimethoxy-21-methyl-5,7-dioxa-13-azahexacyclo[12.7.3.01,13.02,10.04,8.015,20]tetracosa-2,4(8),9,15(20),16,18-hexaen-23-one |
| SMILES | COc1ccc2c(c1OC)C1CC(=O)CC3(c4cc5c(cc4CCN13)OCO5)C2(C)O |
| InChI | InChI=1S/C24H25NO6/c1-23(27)15-4-5-18(28-2)22(29-3)21(15)17-9-14(26)11-24(23)16-10-20-19(30-12-31-20)8-13(16)6-7-25(17)24/h4-5,8,10,17,27H,6-7,9,11-12H2,1-3H3 |
| InChIKey | KOUZYDIFOATULE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |