C19H17NO5 — CID 15286731
(12S)-17-hydroxy-18-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaene-11-carbaldehyde (PubChem CID 15286731) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is (12S)-17-hydroxy-18-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaene-11-carbaldehyde.
| Compound Name | (12S)-17-hydroxy-18-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaene-11-carbaldehyde |
|---|---|
| PubChem CID | 15286731 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (12S)-17-hydroxy-18-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaene-11-carbaldehyde |
| SMILES | COc1c(O)ccc2c1-c1c3c(cc4c1[C@H](C2)N(C=O)CC4)OCO3 |
| InChI | InChI=1S/C19H17NO5/c1-23-18-13(22)3-2-10-6-12-15-11(4-5-20(12)8-21)7-14-19(25-9-24-14)17(15)16(10)18/h2-3,7-8,12,22H,4-6,9H2,1H3/t12-/m0/s1 |
| InChIKey | RTUWYWJLPNOQKH-LBPRGKRZSA-N |
| XLogP | 2.41 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|