C19H19NO4 — CID 163023626
17,18-dimethoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaene (PubChem CID 163023626) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 17,18-dimethoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaene.
| Compound Name | 17,18-dimethoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaene |
|---|---|
| PubChem CID | 163023626 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 17,18-dimethoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaene |
| SMILES | COc1ccc2c(c1OC)-c1c3c(cc4c1C(C2)NCC4)OCO3 |
| InChI | InChI=1S/C19H19NO4/c1-21-13-4-3-10-7-12-15-11(5-6-20-12)8-14-19(24-9-23-14)17(15)16(10)18(13)22-2/h3-4,8,12,20H,5-7,9H2,1-2H3 |
| InChIKey | YYRMPJXNBYSDCA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |