C20H21NO3 — CID 163018059
(12R)-17-methoxy-11,18-dimethyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaene (PubChem CID 163018059) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is (12R)-17-methoxy-11,18-dimethyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaene.
| Compound Name | (12R)-17-methoxy-11,18-dimethyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaene |
|---|---|
| PubChem CID | 163018059 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (12R)-17-methoxy-11,18-dimethyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaene |
| SMILES | COc1ccc2c(c1C)-c1c3c(cc4c1[C@@H](C2)N(C)CC4)OCO3 |
| InChI | InChI=1S/C20H21NO3/c1-11-15(22-3)5-4-12-8-14-18-13(6-7-21(14)2)9-16-20(24-10-23-16)19(18)17(11)12/h4-5,9,14H,6-8,10H2,1-3H3/t14-/m1/s1 |
| InChIKey | BPMRDDOPPZTOCG-CQSZACIVSA-N |
| XLogP | 3.48 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |