C18H17NO4 — CID 162817836
(12S)-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14,16,18-hexaene-16,17-diol (PubChem CID 162817836) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is (12S)-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14,16,18-hexaene-16,17-diol.
| Compound Name | (12S)-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14,16,18-hexaene-16,17-diol |
|---|---|
| PubChem CID | 162817836 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (12S)-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14,16,18-hexaene-16,17-diol |
| SMILES | CN1CCc2cc3c(c4c2[C@@H]1Cc1cc(O)c(O)cc1-4)OCO3 |
| InChI | InChI=1S/C18H17NO4/c1-19-3-2-9-6-15-18(23-8-22-15)17-11-7-14(21)13(20)5-10(11)4-12(19)16(9)17/h5-7,12,20-21H,2-4,8H2,1H3/t12-/m0/s1 |
| InChIKey | CLMZZZSMLRGUJI-LBPRGKRZSA-N |
| XLogP | 2.58 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|