C24H27NO4 — CID 122195415
18-methoxy-13-methyl-19-(3-methylbut-2-enoxy)-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(20),2,4(8),9,16,18-hexaene (PubChem CID 122195415) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 18-methoxy-13-methyl-19-(3-methylbut-2-enoxy)-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(20),2,4(8),9,16,18-hexaene.
| Compound Name | 18-methoxy-13-methyl-19-(3-methylbut-2-enoxy)-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(20),2,4(8),9,16,18-hexaene |
|---|---|
| PubChem CID | 122195415 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 18-methoxy-13-methyl-19-(3-methylbut-2-enoxy)-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(20),2,4(8),9,16,18-hexaene |
| SMILES | COc1cc2c3c(c1OCC=C(C)C)-c1cc4c(cc1CC3N(C)CC2)OCO4 |
| InChI | InChI=1S/C24H27NO4/c1-14(2)6-8-27-24-21(26-4)10-15-5-7-25(3)18-9-16-11-19-20(29-13-28-19)12-17(16)23(24)22(15)18/h6,10-12,18H,5,7-9,13H2,1-4H3 |
| InChIKey | CTSNMJKGZFVWKN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|