C21H25NO2 — CID 21028248
1,10-dimethoxy-2,6,9-trimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline (PubChem CID 21028248) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 1,10-dimethoxy-2,6,9-trimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline.
| Compound Name | 1,10-dimethoxy-2,6,9-trimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline |
|---|---|
| PubChem CID | 21028248 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 1,10-dimethoxy-2,6,9-trimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline |
| SMILES | COc1cc2c(cc1C)CC1c3c(cc(C)c(OC)c3-2)CCN1C |
| InChI | InChI=1S/C21H25NO2/c1-12-8-15-10-17-19-14(6-7-22(17)3)9-13(2)21(24-5)20(19)16(15)11-18(12)23-4/h8-9,11,17H,6-7,10H2,1-5H3 |
| InChIKey | GYBOGYXKYHIKJA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |