C22H28N2O4 — CID 9429813
[(6aR)-1,2,9,10-tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-3-yl]methanamine (PubChem CID 9429813) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is [(6aR)-1,2,9,10-tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-3-yl]methanamine.
| Compound Name | [(6aR)-1,2,9,10-tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-3-yl]methanamine |
|---|---|
| PubChem CID | 9429813 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | [(6aR)-1,2,9,10-tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-3-yl]methanamine |
| SMILES | COc1cc2c(cc1OC)-c1c(OC)c(OC)c(CN)c3c1[C@@H](C2)N(C)CC3 |
| InChI | InChI=1S/C22H28N2O4/c1-24-7-6-13-15(11-23)21(27-4)22(28-5)20-14-10-18(26-3)17(25-2)9-12(14)8-16(24)19(13)20/h9-10,16H,6-8,11,23H2,1-5H3/t16-/m1/s1 |
| InChIKey | ZDLYJHVQGJQEFG-MRXNPFEDSA-N |
| XLogP | 2.93 |
| TPSA | 66.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |