C33H38N2O8 — CID 25147720
(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)-N-[(1,2,9,10-tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-3-yl)methyl]prop-2-enamide (PubChem CID 25147720) has the molecular formula C33H38N2O8 and a molecular weight of 590.67 g/mol. Its IUPAC name is (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)-N-[(1,2,9,10-tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-3-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)-N-[(1,2,9,10-tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-3-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 25147720 |
| Molecular Formula | C33H38N2O8 |
| Molecular Weight | 590.67 g/mol |
| Exact Mass | 590.26 |
| IUPAC Name | (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)-N-[(1,2,9,10-tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-3-yl)methyl]prop-2-enamide |
| SMILES | COc1cc2c(cc1OC)-c1c(OC)c(OC)c(CNC(=O)/C=C/c3cc(OC)c(O)c(OC)c3)c3c1C(C2)N(C)CC3 |
| InChI | InChI=1S/C33H38N2O8/c1-35-11-10-20-22(17-34-28(36)9-8-18-12-26(40-4)31(37)27(13-18)41-5)32(42-6)33(43-7)30-21-16-25(39-3)24(38-2)15-19(21)14-23(35)29(20)30/h8-9,12-13,15-16,23,37H,10-11,14,17H2,1-7H3,(H,34,36)/b9-8+ |
| InChIKey | KSIMWJCBQFJWAR-CMDGGOBGSA-N |
| XLogP | 4.53 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.67 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|