C27H29NO6 — CID 21447070
9-(3,4-dimethoxyphenoxy)-2,10-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol (PubChem CID 21447070) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is 9-(3,4-dimethoxyphenoxy)-2,10-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol.
| Compound Name | 9-(3,4-dimethoxyphenoxy)-2,10-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol |
|---|---|
| PubChem CID | 21447070 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 9-(3,4-dimethoxyphenoxy)-2,10-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol |
| SMILES | COc1ccc(Oc2cc3c(cc2OC)-c2c(O)c(OC)cc4c2C(C3)N(C)CC4)cc1OC |
| InChI | InChI=1S/C27H29NO6/c1-28-9-8-15-11-24(33-5)27(29)26-18-14-22(32-4)23(12-16(18)10-19(28)25(15)26)34-17-6-7-20(30-2)21(13-17)31-3/h6-7,11-14,19,29H,8-10H2,1-5H3 |
| InChIKey | LMMMIBNCYWBRIX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |