C19H21NO4 — CID 44559867
(6aR)-1,2-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol (PubChem CID 44559867) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is (6aR)-1,2-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol.
| Compound Name | (6aR)-1,2-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol |
|---|---|
| PubChem CID | 44559867 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (6aR)-1,2-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol |
| SMILES | COc1cc2c3c(c1OC)-c1c(ccc(O)c1O)C[C@H]3N(C)CC2 |
| InChI | InChI=1S/C19H21NO4/c1-20-7-6-11-9-14(23-2)19(24-3)17-15(11)12(20)8-10-4-5-13(21)18(22)16(10)17/h4-5,9,12,21-22H,6-8H2,1-3H3/t12-/m1/s1 |
| InChIKey | FNHRMNVLZGCBIE-GFCCVEGCSA-N |
| XLogP | 2.87 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|