C21H25NO4 — CID 162642216
(6aS)-1,10-dimethoxy-6-methyl-2,9-bis(trideuteriomethoxy)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline (PubChem CID 162642216) has the molecular formula C21H25NO4 and a molecular weight of 361.47 g/mol. Its IUPAC name is (6aS)-1,10-dimethoxy-6-methyl-2,9-bis(trideuteriomethoxy)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline.
| Compound Name | (6aS)-1,10-dimethoxy-6-methyl-2,9-bis(trideuteriomethoxy)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline |
|---|---|
| PubChem CID | 162642216 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | (6aS)-1,10-dimethoxy-6-methyl-2,9-bis(trideuteriomethoxy)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline |
| SMILES | [2H]C([2H])([2H])Oc1cc2c(cc1OC)-c1c(OC)c(OC([2H])([2H])[2H])cc3c1[C@H](C2)N(C)CC3 |
| InChI | InChI=1S/C21H25NO4/c1-22-7-6-12-9-18(25-4)21(26-5)20-14-11-17(24-3)16(23-2)10-13(14)8-15(22)19(12)20/h9-11,15H,6-8H2,1-5H3/t15-/m0/s1/i2D3,4D3 |
| InChIKey | RUZIUYOSRDWYQF-LZROVGFOSA-N |
| XLogP | 3.47 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |