C21H22F3NO6S — CID 101438360
(1,2,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-9-yl) trifluoromethanesulfonate (PubChem CID 101438360) has the molecular formula C21H22F3NO6S and a molecular weight of 473.47 g/mol. Its IUPAC name is (1,2,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-9-yl) trifluoromethanesulfonate.
| Compound Name | (1,2,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-9-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 101438360 |
| Molecular Formula | C21H22F3NO6S |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | (1,2,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-9-yl) trifluoromethanesulfonate |
| SMILES | COc1cc2c(cc1OS(=O)(=O)C(F)(F)F)CC1c3c(cc(OC)c(OC)c3-2)CCN1C |
| InChI | InChI=1S/C21H22F3NO6S/c1-25-6-5-11-8-17(29-3)20(30-4)19-13-10-15(28-2)16(31-32(26,27)21(22,23)24)9-12(13)7-14(25)18(11)19/h8-10,14H,5-7H2,1-4H3 |
| InChIKey | PMUZDAGBJHJTFP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|