C20H21NO6S — CID 46918940
18,19-dimethoxy-13-methylsulfonyl-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(20),2,4(8),9,16,18-hexaene (PubChem CID 46918940) has the molecular formula C20H21NO6S and a molecular weight of 403.46 g/mol. Its IUPAC name is 18,19-dimethoxy-13-methylsulfonyl-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(20),2,4(8),9,16,18-hexaene.
| Compound Name | 18,19-dimethoxy-13-methylsulfonyl-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(20),2,4(8),9,16,18-hexaene |
|---|---|
| PubChem CID | 46918940 |
| Molecular Formula | C20H21NO6S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 18,19-dimethoxy-13-methylsulfonyl-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(20),2,4(8),9,16,18-hexaene |
| SMILES | COc1cc2c3c(c1OC)-c1cc4c(cc1CC3N(S(C)(=O)=O)CC2)OCO4 |
| InChI | InChI=1S/C20H21NO6S/c1-24-17-7-11-4-5-21(28(3,22)23)14-6-12-8-15-16(27-10-26-15)9-13(12)19(18(11)14)20(17)25-2/h7-9,14H,4-6,10H2,1-3H3 |
| InChIKey | QNHBDNRZLCNOBA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |