C23H25NO4 — CID 42629119
19-(cyclopropylmethoxy)-18-methoxy-13-methyl-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(20),2,4(8),9,16,18-hexaene (PubChem CID 42629119) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 19-(cyclopropylmethoxy)-18-methoxy-13-methyl-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(20),2,4(8),9,16,18-hexaene.
| Compound Name | 19-(cyclopropylmethoxy)-18-methoxy-13-methyl-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(20),2,4(8),9,16,18-hexaene |
|---|---|
| PubChem CID | 42629119 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 19-(cyclopropylmethoxy)-18-methoxy-13-methyl-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(20),2,4(8),9,16,18-hexaene |
| SMILES | COc1cc2c3c(c1OCC1CC1)-c1cc4c(cc1CC3N(C)CC2)OCO4 |
| InChI | InChI=1S/C23H25NO4/c1-24-6-5-14-8-20(25-2)23(26-11-13-3-4-13)22-16-10-19-18(27-12-28-19)9-15(16)7-17(24)21(14)22/h8-10,13,17H,3-7,11-12H2,1-2H3 |
| InChIKey | RKEZRCGMHSDZHH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |