C20H20F3NO6S — CID 154049412
[(6aS)-1,2,10-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-9-yl] trifluoromethanesulfonate (PubChem CID 154049412) has the molecular formula C20H20F3NO6S and a molecular weight of 459.44 g/mol. Its IUPAC name is [(6aS)-1,2,10-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-9-yl] trifluoromethanesulfonate.
| Compound Name | [(6aS)-1,2,10-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-9-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 154049412 |
| Molecular Formula | C20H20F3NO6S |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | [(6aS)-1,2,10-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-9-yl] trifluoromethanesulfonate |
| SMILES | COc1cc2c(cc1OS(=O)(=O)C(F)(F)F)C[C@@H]1NCCc3cc(OC)c(OC)c-2c31 |
| InChI | InChI=1S/C20H20F3NO6S/c1-27-14-9-12-11(8-15(14)30-31(25,26)20(21,22)23)6-13-17-10(4-5-24-13)7-16(28-2)19(29-3)18(12)17/h7-9,13,24H,4-6H2,1-3H3/t13-/m0/s1 |
| InChIKey | AOOFEASJVWAOBA-ZDUSSCGKSA-N |
| XLogP | 3.35 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|