C20H23NO5 — CID 14378683
1,2,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-3,11-diol (PubChem CID 14378683) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1,2,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-3,11-diol.
| Compound Name | 1,2,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-3,11-diol |
|---|---|
| PubChem CID | 14378683 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 1,2,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-3,11-diol |
| SMILES | COc1ccc2c(c1O)-c1c(OC)c(OC)c(O)c3c1C(C2)N(C)CC3 |
| InChI | InChI=1S/C20H23NO5/c1-21-8-7-11-15-12(21)9-10-5-6-13(24-2)18(23)14(10)16(15)19(25-3)20(26-4)17(11)22/h5-6,12,22-23H,7-9H2,1-4H3 |
| InChIKey | ZLDNXEZNXWTKLG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |