C19H21NO5 — CID 14378685
1,2,10-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-3,11-diol (PubChem CID 14378685) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is 1,2,10-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-3,11-diol.
| Compound Name | 1,2,10-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-3,11-diol |
|---|---|
| PubChem CID | 14378685 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1,2,10-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-3,11-diol |
| SMILES | COc1ccc2c(c1O)-c1c(OC)c(OC)c(O)c3c1C(C2)NCC3 |
| InChI | InChI=1S/C19H21NO5/c1-23-12-5-4-9-8-11-14-10(6-7-20-11)16(21)19(25-3)18(24-2)15(14)13(9)17(12)22/h4-5,11,20-22H,6-8H2,1-3H3 |
| InChIKey | BVPOIURGGIALFW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |