C18H19NO2S — CID 23238144
10-methoxy-6-methyl-3-sulfanyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-ol (PubChem CID 23238144) has the molecular formula C18H19NO2S and a molecular weight of 313.42 g/mol. Its IUPAC name is 10-methoxy-6-methyl-3-sulfanyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-ol.
| Compound Name | 10-methoxy-6-methyl-3-sulfanyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-ol |
|---|---|
| PubChem CID | 23238144 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 10-methoxy-6-methyl-3-sulfanyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-ol |
| SMILES | COc1ccc2c(c1O)-c1ccc(S)c3c1C(C2)N(C)CC3 |
| InChI | InChI=1S/C18H19NO2S/c1-19-8-7-11-15(22)6-4-12-16-10(9-13(19)17(11)12)3-5-14(21-2)18(16)20/h3-6,13,20,22H,7-9H2,1-2H3 |
| InChIKey | VOBUTUTXHVWGKE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|