C34H35ClN2O4 — CID 3046132
bis((6aR)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol);hydrochloride (PubChem CID 3046132) has the molecular formula C34H35ClN2O4 and a molecular weight of 571.12 g/mol. Its IUPAC name is bis((6aR)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol);hydrochloride.
| Compound Name | bis((6aR)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol);hydrochloride |
|---|---|
| PubChem CID | 3046132 |
| Molecular Formula | C34H35ClN2O4 |
| Molecular Weight | 571.12 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | bis((6aR)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol);hydrochloride |
| SMILES | CN1CCc2cccc3c2[C@H]1Cc1ccc(O)c(O)c1-3.CN1CCc2cccc3c2[C@H]1Cc1ccc(O)c(O)c1-3.Cl |
| InChI | InChI=1S/2C17H17NO2.ClH/c2*1-18-8-7-10-3-2-4-12-15(10)13(18)9-11-5-6-14(19)17(20)16(11)12;/h2*2-6,13,19-20H,7-9H2,1H3;1H/t2*13-;/m11./s1 |
| InChIKey | KXFJCUBOPYFXAN-WFEKIRLUSA-N |
| XLogP | 6.12 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.12 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|