C17H18NNaO2 — CID 174625151
sodium;(6aR)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol;hydride (PubChem CID 174625151) has the molecular formula C17H18NNaO2 and a molecular weight of 291.33 g/mol. Its IUPAC name is sodium;(6aR)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol;hydride.
| Compound Name | sodium;(6aR)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol;hydride |
|---|---|
| PubChem CID | 174625151 |
| Molecular Formula | C17H18NNaO2 |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | sodium;(6aR)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol;hydride |
| SMILES | CN1CCc2cccc3c2[C@H]1Cc1ccc(O)c(O)c1-3.[H-].[Na+] |
| InChI | InChI=1S/C17H17NO2.Na.H/c1-18-8-7-10-3-2-4-12-15(10)13(18)9-11-5-6-14(19)17(20)16(11)12;;/h2-6,13,19-20H,7-9H2,1H3;;/q;+1;-1/t13-;;/m1../s1 |
| InChIKey | HIWZPSAGMHOIEX-FFXKMJQXSA-N |
| XLogP | -0.03 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|