C21H23NO6 — CID 162984652
methyl (6aS)-2-hydroxy-1,9,10-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-6-carboxylate (PubChem CID 162984652) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is methyl (6aS)-2-hydroxy-1,9,10-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-6-carboxylate.
| Compound Name | methyl (6aS)-2-hydroxy-1,9,10-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 162984652 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | methyl (6aS)-2-hydroxy-1,9,10-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-6-carboxylate |
| SMILES | COC(=O)N1CCc2cc(O)c(OC)c3c2[C@@H]1Cc1cc(OC)c(OC)cc1-3 |
| InChI | InChI=1S/C21H23NO6/c1-25-16-9-12-7-14-18-11(5-6-22(14)21(24)28-4)8-15(23)20(27-3)19(18)13(12)10-17(16)26-2/h8-10,14,23H,5-7H2,1-4H3/t14-/m0/s1 |
| InChIKey | HUNDOXNVOAEPPU-AWEZNQCLSA-N |
| XLogP | 3.31 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |