C22H25NO6 — CID 11825504
methyl 1,2,10,11-tetramethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-6-carboxylate (PubChem CID 11825504) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is methyl 1,2,10,11-tetramethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-6-carboxylate.
| Compound Name | methyl 1,2,10,11-tetramethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 11825504 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | methyl 1,2,10,11-tetramethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-6-carboxylate |
| SMILES | COC(=O)N1CCc2cc(OC)c(OC)c3c2C1Cc1ccc(OC)c(OC)c1-3 |
| InChI | InChI=1S/C22H25NO6/c1-25-15-7-6-12-10-14-17-13(8-9-23(14)22(24)29-5)11-16(26-2)21(28-4)19(17)18(12)20(15)27-3/h6-7,11,14H,8-10H2,1-5H3 |
| InChIKey | BZTSNKOILDKTCF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |