C24H27NO7 — CID 74039794
(1-acetyloxy-2,10,11-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-4-yl) acetate (PubChem CID 74039794) has the molecular formula C24H27NO7 and a molecular weight of 441.48 g/mol. Its IUPAC name is (1-acetyloxy-2,10,11-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-4-yl) acetate.
| Compound Name | (1-acetyloxy-2,10,11-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-4-yl) acetate |
|---|---|
| PubChem CID | 74039794 |
| Molecular Formula | C24H27NO7 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | (1-acetyloxy-2,10,11-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-4-yl) acetate |
| SMILES | COc1ccc2c(c1OC)-c1c(OC(C)=O)c(OC)cc3c1C(C2)N(C)CC3OC(C)=O |
| InChI | InChI=1S/C24H27NO7/c1-12(26)31-19-11-25(3)16-9-14-7-8-17(28-4)23(30-6)20(14)22-21(16)15(19)10-18(29-5)24(22)32-13(2)27/h7-8,10,16,19H,9,11H2,1-6H3 |
| InChIKey | WEDXHGNHMJCVAW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|