C20H21NO5 — CID 163009713
(12S)-17,18,19-trimethoxy-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),9,16(20),17-hexaene (PubChem CID 163009713) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is (12S)-17,18,19-trimethoxy-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),9,16(20),17-hexaene.
| Compound Name | (12S)-17,18,19-trimethoxy-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),9,16(20),17-hexaene |
|---|---|
| PubChem CID | 163009713 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (12S)-17,18,19-trimethoxy-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),9,16(20),17-hexaene |
| SMILES | COc1c2c3c(c(OC)c1OC)-c1cc4c(cc1C[C@@H]3NCC2)OCO4 |
| InChI | InChI=1S/C20H21NO5/c1-22-18-11-4-5-21-13-6-10-7-14-15(26-9-25-14)8-12(10)17(16(11)13)19(23-2)20(18)24-3/h7-8,13,21H,4-6,9H2,1-3H3/t13-/m0/s1 |
| InChIKey | BRFSQLJZEXODAM-ZDUSSCGKSA-N |
| XLogP | 2.85 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |