C20H19NO6 — CID 162897167
17-hydroxy-7,16-dimethoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1,6,8(20),14,16,18-hexaene-11-carbaldehyde (PubChem CID 162897167) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is 17-hydroxy-7,16-dimethoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1,6,8(20),14,16,18-hexaene-11-carbaldehyde.
| Compound Name | 17-hydroxy-7,16-dimethoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1,6,8(20),14,16,18-hexaene-11-carbaldehyde |
|---|---|
| PubChem CID | 162897167 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 17-hydroxy-7,16-dimethoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1,6,8(20),14,16,18-hexaene-11-carbaldehyde |
| SMILES | COc1cc2c(cc1O)-c1c3c(c(OC)c4c1C(C2)N(C=O)CC4)OCO3 |
| InChI | InChI=1S/C20H19NO6/c1-24-15-6-10-5-13-16-11(3-4-21(13)8-22)18(25-2)20-19(26-9-27-20)17(16)12(10)7-14(15)23/h6-8,13,23H,3-5,9H2,1-2H3 |
| InChIKey | OZSGJODEHSOWQG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|