C19H18N2O4 — CID 78117500
16-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaene-11-carboxamide (PubChem CID 78117500) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 16-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaene-11-carboxamide.
| Compound Name | 16-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaene-11-carboxamide |
|---|---|
| PubChem CID | 78117500 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 16-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaene-11-carboxamide |
| SMILES | COc1ccc2c(c1)CC1c3c(cc4c(c3-2)OCO4)CCN1C(N)=O |
| InChI | InChI=1S/C19H18N2O4/c1-23-12-2-3-13-11(6-12)7-14-16-10(4-5-21(14)19(20)22)8-15-18(17(13)16)25-9-24-15/h2-3,6,8,14H,4-5,7,9H2,1H3,(H2,20,22) |
| InChIKey | NTYLUWKAVWOEMV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |