C19H20NO3+ — CID 6947022
(12R)-17-methoxy-11-methyl-3,5-dioxa-11-azoniapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaene (PubChem CID 6947022) has the molecular formula C19H20NO3+ and a molecular weight of 310.37 g/mol. Its IUPAC name is (12R)-17-methoxy-11-methyl-3,5-dioxa-11-azoniapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaene.
| Compound Name | (12R)-17-methoxy-11-methyl-3,5-dioxa-11-azoniapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaene |
|---|---|
| PubChem CID | 6947022 |
| Molecular Formula | C19H20NO3+ |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (12R)-17-methoxy-11-methyl-3,5-dioxa-11-azoniapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaene |
| SMILES | COc1ccc2c(c1)-c1c3c(cc4c1[C@@H](C2)[NH+](C)CC4)OCO3 |
| InChI | InChI=1S/C19H19NO3/c1-20-6-5-12-8-16-19(23-10-22-16)18-14-9-13(21-2)4-3-11(14)7-15(20)17(12)18/h3-4,8-9,15H,5-7,10H2,1-2H3/p+1/t15-/m1/s1 |
| InChIKey | CXHXSNCRZOIVQW-OAHLLOKOSA-O |
| XLogP | 1.76 |
| TPSA | 32.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |