C22H28NO6+ — CID 7079054
(1S)-1-(2,4-dimethoxyphenyl)-2-[(5S)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]ethanol (PubChem CID 7079054) has the molecular formula C22H28NO6+ and a molecular weight of 402.47 g/mol. Its IUPAC name is (1S)-1-(2,4-dimethoxyphenyl)-2-[(5S)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]ethanol.
| Compound Name | (1S)-1-(2,4-dimethoxyphenyl)-2-[(5S)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]ethanol |
|---|---|
| PubChem CID | 7079054 |
| Molecular Formula | C22H28NO6+ |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (1S)-1-(2,4-dimethoxyphenyl)-2-[(5S)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]ethanol |
| SMILES | COc1ccc([C@@H](O)C[C@H]2c3c(cc4c(c3OC)OCO4)CC[NH+]2C)c(OC)c1 |
| InChI | InChI=1S/C22H27NO6/c1-23-8-7-13-9-19-21(29-12-28-19)22(27-4)20(13)16(23)11-17(24)15-6-5-14(25-2)10-18(15)26-3/h5-6,9-10,16-17,24H,7-8,11-12H2,1-4H3/p+1/t16-,17-/m0/s1 |
| InChIKey | YLFOXWHTQSYROJ-IRXDYDNUSA-O |
| XLogP | 1.68 |
| TPSA | 70.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |