C20H24N3O5+ — CID 7079074
1-[(5R)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-3-(3-methoxyphenyl)urea (PubChem CID 7079074) has the molecular formula C20H24N3O5+ and a molecular weight of 386.43 g/mol. Its IUPAC name is 1-[(5R)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[(5R)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 7079074 |
| Molecular Formula | C20H24N3O5+ |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-[(5R)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)N[C@H]2c3c(cc4c(c3OC)OCO4)CC[NH+]2C)c1 |
| InChI | InChI=1S/C20H23N3O5/c1-23-8-7-12-9-15-17(28-11-27-15)18(26-3)16(12)19(23)22-20(24)21-13-5-4-6-14(10-13)25-2/h4-6,9-10,19H,7-8,11H2,1-3H3,(H2,21,22,24)/p+1/t19-/m1/s1 |
| InChIKey | MLJYZOQWPQJOFA-LJQANCHMSA-O |
| XLogP | 1.32 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |