C22H28N4O4 — CID 10295162
1-(3-methoxyphenyl)-3-[3-[(3-methoxyphenyl)carbamoylamino]cyclohexyl]urea (PubChem CID 10295162) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-[3-[(3-methoxyphenyl)carbamoylamino]cyclohexyl]urea.
| Compound Name | 1-(3-methoxyphenyl)-3-[3-[(3-methoxyphenyl)carbamoylamino]cyclohexyl]urea |
|---|---|
| PubChem CID | 10295162 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-[3-[(3-methoxyphenyl)carbamoylamino]cyclohexyl]urea |
| SMILES | COc1cccc(NC(=O)NC2CCCC(NC(=O)Nc3cccc(OC)c3)C2)c1 |
| InChI | InChI=1S/C22H28N4O4/c1-29-19-10-4-8-17(13-19)25-21(27)23-15-6-3-7-16(12-15)24-22(28)26-18-9-5-11-20(14-18)30-2/h4-5,8-11,13-16H,3,6-7,12H2,1-2H3,(H2,23,25,27)(H2,24,26,28) |
| InChIKey | FNTAEIPCZBYVBU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |