C19H27N3O2 — CID 1461728
1-(3-methoxyphenyl)-3-[(1R,5R)-9-prop-2-enyl-9-azabicyclo[3.3.1]nonan-3-yl]urea (PubChem CID 1461728) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-[(1R,5R)-9-prop-2-enyl-9-azabicyclo[3.3.1]nonan-3-yl]urea.
| Compound Name | 1-(3-methoxyphenyl)-3-[(1R,5R)-9-prop-2-enyl-9-azabicyclo[3.3.1]nonan-3-yl]urea |
|---|---|
| PubChem CID | 1461728 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-[(1R,5R)-9-prop-2-enyl-9-azabicyclo[3.3.1]nonan-3-yl]urea |
| SMILES | C=CCN1[C@@H]2CCC[C@@H]1CC(NC(=O)Nc1cccc(OC)c1)C2 |
| InChI | InChI=1S/C19H27N3O2/c1-3-10-22-16-7-5-8-17(22)12-15(11-16)21-19(23)20-14-6-4-9-18(13-14)24-2/h3-4,6,9,13,15-17H,1,5,7-8,10-12H2,2H3,(H2,20,21,23)/t16-,17-/m1/s1 |
| InChIKey | LHQZXYFMZFZJKX-IAGOWNOFSA-N |
| XLogP | 3.39 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|