C20H31N3O — CID 7403457
1-[(1R,5R)-9-butyl-9-azabicyclo[3.3.1]nonan-3-yl]-3-(3-methylphenyl)urea (PubChem CID 7403457) has the molecular formula C20H31N3O and a molecular weight of 329.49 g/mol. Its IUPAC name is 1-[(1R,5R)-9-butyl-9-azabicyclo[3.3.1]nonan-3-yl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[(1R,5R)-9-butyl-9-azabicyclo[3.3.1]nonan-3-yl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 7403457 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | 1-[(1R,5R)-9-butyl-9-azabicyclo[3.3.1]nonan-3-yl]-3-(3-methylphenyl)urea |
| SMILES | CCCCN1[C@@H]2CCC[C@@H]1CC(NC(=O)Nc1cccc(C)c1)C2 |
| InChI | InChI=1S/C20H31N3O/c1-3-4-11-23-18-9-6-10-19(23)14-17(13-18)22-20(24)21-16-8-5-7-15(2)12-16/h5,7-8,12,17-19H,3-4,6,9-11,13-14H2,1-2H3,(H2,21,22,24)/t18-,19-/m1/s1 |
| InChIKey | DZOVUUTXQPFIKA-RTBURBONSA-N |
| XLogP | 4.30 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |