C18H24FN3O — CID 1461746
1-(3-fluorophenyl)-3-[(1S,5S)-9-prop-2-enyl-9-azabicyclo[3.3.1]nonan-3-yl]urea (PubChem CID 1461746) has the molecular formula C18H24FN3O and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[(1S,5S)-9-prop-2-enyl-9-azabicyclo[3.3.1]nonan-3-yl]urea.
| Compound Name | 1-(3-fluorophenyl)-3-[(1S,5S)-9-prop-2-enyl-9-azabicyclo[3.3.1]nonan-3-yl]urea |
|---|---|
| PubChem CID | 1461746 |
| Molecular Formula | C18H24FN3O |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[(1S,5S)-9-prop-2-enyl-9-azabicyclo[3.3.1]nonan-3-yl]urea |
| SMILES | C=CCN1[C@H]2CCC[C@H]1CC(NC(=O)Nc1cccc(F)c1)C2 |
| InChI | InChI=1S/C18H24FN3O/c1-2-9-22-16-7-4-8-17(22)12-15(11-16)21-18(23)20-14-6-3-5-13(19)10-14/h2-3,5-6,10,15-17H,1,4,7-9,11-12H2,(H2,20,21,23)/t16-,17-/m0/s1 |
| InChIKey | KQWXLKHHSGZXMJ-IRXDYDNUSA-N |
| XLogP | 3.52 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|