C18H31N3O — CID 98110146
1-cyclohexyl-3-[(1S,5S)-9-prop-2-enyl-9-azabicyclo[3.3.1]nonan-3-yl]urea (PubChem CID 98110146) has the molecular formula C18H31N3O and a molecular weight of 305.47 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(1S,5S)-9-prop-2-enyl-9-azabicyclo[3.3.1]nonan-3-yl]urea.
| Compound Name | 1-cyclohexyl-3-[(1S,5S)-9-prop-2-enyl-9-azabicyclo[3.3.1]nonan-3-yl]urea |
|---|---|
| PubChem CID | 98110146 |
| Molecular Formula | C18H31N3O |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | 1-cyclohexyl-3-[(1S,5S)-9-prop-2-enyl-9-azabicyclo[3.3.1]nonan-3-yl]urea |
| SMILES | C=CCN1[C@H]2CCC[C@H]1CC(NC(=O)NC1CCCCC1)C2 |
| InChI | InChI=1S/C18H31N3O/c1-2-11-21-16-9-6-10-17(21)13-15(12-16)20-18(22)19-14-7-4-3-5-8-14/h2,14-17H,1,3-13H2,(H2,19,20,22)/t16-,17-/m0/s1 |
| InChIKey | YQDIISZSEKGREV-IRXDYDNUSA-N |
| XLogP | 3.19 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|