C21H36N4OS — CID 98111296
1-cyclohexyl-3-[(1S,5S)-8-(cyclohexylcarbamothioyl)-8-azabicyclo[3.2.1]octan-3-yl]urea (PubChem CID 98111296) has the molecular formula C21H36N4OS and a molecular weight of 392.61 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(1S,5S)-8-(cyclohexylcarbamothioyl)-8-azabicyclo[3.2.1]octan-3-yl]urea.
| Compound Name | 1-cyclohexyl-3-[(1S,5S)-8-(cyclohexylcarbamothioyl)-8-azabicyclo[3.2.1]octan-3-yl]urea |
|---|---|
| PubChem CID | 98111296 |
| Molecular Formula | C21H36N4OS |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 1-cyclohexyl-3-[(1S,5S)-8-(cyclohexylcarbamothioyl)-8-azabicyclo[3.2.1]octan-3-yl]urea |
| SMILES | O=C(NC1CCCCC1)NC1C[C@@H]2CC[C@@H](C1)N2C(=S)NC1CCCCC1 |
| InChI | InChI=1S/C21H36N4OS/c26-20(22-15-7-3-1-4-8-15)23-17-13-18-11-12-19(14-17)25(18)21(27)24-16-9-5-2-6-10-16/h15-19H,1-14H2,(H,24,27)(H2,22,23,26)/t18-,19-/m0/s1 |
| InChIKey | ASSISOVLAIKDBR-OALUTQOASA-N |
| XLogP | 3.82 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|