C20H36N4O2S — CID 7411477
1-cyclohexyl-3-[(1R,5R)-8-(3-ethoxypropylcarbamothioyl)-8-azabicyclo[3.2.1]octan-3-yl]urea (PubChem CID 7411477) has the molecular formula C20H36N4O2S and a molecular weight of 396.60 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(1R,5R)-8-(3-ethoxypropylcarbamothioyl)-8-azabicyclo[3.2.1]octan-3-yl]urea.
| Compound Name | 1-cyclohexyl-3-[(1R,5R)-8-(3-ethoxypropylcarbamothioyl)-8-azabicyclo[3.2.1]octan-3-yl]urea |
|---|---|
| PubChem CID | 7411477 |
| Molecular Formula | C20H36N4O2S |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 1-cyclohexyl-3-[(1R,5R)-8-(3-ethoxypropylcarbamothioyl)-8-azabicyclo[3.2.1]octan-3-yl]urea |
| SMILES | CCOCCCNC(=S)N1[C@@H]2CC[C@@H]1CC(NC(=O)NC1CCCCC1)C2 |
| InChI | InChI=1S/C20H36N4O2S/c1-2-26-12-6-11-21-20(27)24-17-9-10-18(24)14-16(13-17)23-19(25)22-15-7-4-3-5-8-15/h15-18H,2-14H2,1H3,(H,21,27)(H2,22,23,25)/t17-,18-/m1/s1 |
| InChIKey | HMAMSDRUYWHYFN-QZTJIDSGSA-N |
| XLogP | 2.91 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|