C18H34N2O4 — CID 94820992
cis-(1S,3R)-1-N,3-N-bis(3-ethoxypropyl)cyclohexane-1,3-dicarboxamide (PubChem CID 94820992) has the molecular formula C18H34N2O4 and a molecular weight of 342.48 g/mol. Its IUPAC name is cis-(1S,3R)-1-N,3-N-bis(3-ethoxypropyl)cyclohexane-1,3-dicarboxamide.
| Compound Name | cis-(1S,3R)-1-N,3-N-bis(3-ethoxypropyl)cyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 94820992 |
| Molecular Formula | C18H34N2O4 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | cis-(1S,3R)-1-N,3-N-bis(3-ethoxypropyl)cyclohexane-1,3-dicarboxamide |
| SMILES | CCOCCCNC(=O)[C@@H]1CCC[C@H](C(=O)NCCCOCC)C1 |
| InChI | InChI=1S/C18H34N2O4/c1-3-23-12-6-10-19-17(21)15-8-5-9-16(14-15)18(22)20-11-7-13-24-4-2/h15-16H,3-14H2,1-2H3,(H,19,21)(H,20,22)/t15-,16+ |
| InChIKey | FYCZQIURXWVHRU-IYBDPMFKSA-N |
| XLogP | 1.88 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|