C13H26N2O2 — CID 120622256
(2S,4S)-N-(4-ethoxybutyl)-2-methylpiperidine-4-carboxamide (PubChem CID 120622256) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is (2S,4S)-N-(4-ethoxybutyl)-2-methylpiperidine-4-carboxamide.
| Compound Name | (2S,4S)-N-(4-ethoxybutyl)-2-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120622256 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | (2S,4S)-N-(4-ethoxybutyl)-2-methylpiperidine-4-carboxamide |
| SMILES | CCOCCCCNC(=O)[C@H]1CCN[C@@H](C)C1 |
| InChI | InChI=1S/C13H26N2O2/c1-3-17-9-5-4-7-15-13(16)12-6-8-14-11(2)10-12/h11-12,14H,3-10H2,1-2H3,(H,15,16)/t11-,12-/m0/s1 |
| InChIKey | RLRYQFGGRZYOJB-RYUDHWBXSA-N |
| XLogP | 1.31 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|