C13H27N3O3S — CID 120624764
(2S,4S)-N-[3-[ethyl(methylsulfonyl)amino]propyl]-2-methylpiperidine-4-carboxamide (PubChem CID 120624764) has the molecular formula C13H27N3O3S and a molecular weight of 305.44 g/mol. Its IUPAC name is (2S,4S)-N-[3-[ethyl(methylsulfonyl)amino]propyl]-2-methylpiperidine-4-carboxamide.
| Compound Name | (2S,4S)-N-[3-[ethyl(methylsulfonyl)amino]propyl]-2-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120624764 |
| Molecular Formula | C13H27N3O3S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | (2S,4S)-N-[3-[ethyl(methylsulfonyl)amino]propyl]-2-methylpiperidine-4-carboxamide |
| SMILES | CCN(CCCNC(=O)[C@H]1CCN[C@@H](C)C1)S(C)(=O)=O |
| InChI | InChI=1S/C13H27N3O3S/c1-4-16(20(3,18)19)9-5-7-15-13(17)12-6-8-14-11(2)10-12/h11-12,14H,4-10H2,1-3H3,(H,15,17)/t11-,12-/m0/s1 |
| InChIKey | QEEBKBKLZUFQIP-RYUDHWBXSA-N |
| XLogP | 0.16 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|