C15H29N3O3S — CID 119299945
N-[3-[ethyl(methylsulfonyl)amino]propyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 119299945) has the molecular formula C15H29N3O3S and a molecular weight of 331.48 g/mol. Its IUPAC name is N-[3-[ethyl(methylsulfonyl)amino]propyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[3-[ethyl(methylsulfonyl)amino]propyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 119299945 |
| Molecular Formula | C15H29N3O3S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | N-[3-[ethyl(methylsulfonyl)amino]propyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CCN(CCCNC(=O)C1CC2CCCCC2N1)S(C)(=O)=O |
| InChI | InChI=1S/C15H29N3O3S/c1-3-18(22(2,20)21)10-6-9-16-15(19)14-11-12-7-4-5-8-13(12)17-14/h12-14,17H,3-11H2,1-2H3,(H,16,19) |
| InChIKey | BWJUIYFNHSJIIY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|