C15H29ClN2O2 — CID 119288793
N-(4-ethoxybutyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119288793) has the molecular formula C15H29ClN2O2 and a molecular weight of 304.86 g/mol. Its IUPAC name is N-(4-ethoxybutyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-(4-ethoxybutyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119288793 |
| Molecular Formula | C15H29ClN2O2 |
| Molecular Weight | 304.86 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | N-(4-ethoxybutyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | CCOCCCCNC(=O)C1CC2CCCCC2N1.Cl |
| InChI | InChI=1S/C15H28N2O2.ClH/c1-2-19-10-6-5-9-16-15(18)14-11-12-7-3-4-8-13(12)17-14;/h12-14,17H,2-11H2,1H3,(H,16,18);1H |
| InChIKey | MLEGXKZINGTDBE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.86 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|