C20H31ClN2O4 — CID 119344804
N-[3-(3,5-dimethoxyphenoxy)propyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119344804) has the molecular formula C20H31ClN2O4 and a molecular weight of 398.93 g/mol. Its IUPAC name is N-[3-(3,5-dimethoxyphenoxy)propyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-[3-(3,5-dimethoxyphenoxy)propyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119344804 |
| Molecular Formula | C20H31ClN2O4 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | N-[3-(3,5-dimethoxyphenoxy)propyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | COc1cc(OC)cc(OCCCNC(=O)C2CC3CCCCC3N2)c1.Cl |
| InChI | InChI=1S/C20H30N2O4.ClH/c1-24-15-11-16(25-2)13-17(12-15)26-9-5-8-21-20(23)19-10-14-6-3-4-7-18(14)22-19;/h11-14,18-19,22H,3-10H2,1-2H3,(H,21,23);1H |
| InChIKey | WIWMCKUPDKGUBP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|