C19H29ClN2O4 — CID 119271840
N-[(2,4,5-trimethoxyphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119271840) has the molecular formula C19H29ClN2O4 and a molecular weight of 384.90 g/mol. Its IUPAC name is N-[(2,4,5-trimethoxyphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-[(2,4,5-trimethoxyphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119271840 |
| Molecular Formula | C19H29ClN2O4 |
| Molecular Weight | 384.90 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | N-[(2,4,5-trimethoxyphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | COc1cc(OC)c(OC)cc1CNC(=O)C1CC2CCCCC2N1.Cl |
| InChI | InChI=1S/C19H28N2O4.ClH/c1-23-16-10-18(25-3)17(24-2)9-13(16)11-20-19(22)15-8-12-6-4-5-7-14(12)21-15;/h9-10,12,14-15,21H,4-8,11H2,1-3H3,(H,20,22);1H |
| InChIKey | ZIOXTNRZOOUCII-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.90 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |