C18H27ClN2OS — CID 119339618
N-[(4-methyl-2-methylsulfanylphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119339618) has the molecular formula C18H27ClN2OS and a molecular weight of 354.95 g/mol. Its IUPAC name is N-[(4-methyl-2-methylsulfanylphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-[(4-methyl-2-methylsulfanylphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119339618 |
| Molecular Formula | C18H27ClN2OS |
| Molecular Weight | 354.95 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N-[(4-methyl-2-methylsulfanylphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | CSc1cc(C)ccc1CNC(=O)C1CC2CCCCC2N1.Cl |
| InChI | InChI=1S/C18H26N2OS.ClH/c1-12-7-8-14(17(9-12)22-2)11-19-18(21)16-10-13-5-3-4-6-15(13)20-16;/h7-9,13,15-16,20H,3-6,10-11H2,1-2H3,(H,19,21);1H |
| InChIKey | YATMUPVJEUHACL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.95 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |