C22H29Cl2N3O3 — CID 119847897
N-[[2-(4-methoxyphenoxy)-4-pyridinyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride (PubChem CID 119847897) has the molecular formula C22H29Cl2N3O3 and a molecular weight of 454.40 g/mol. Its IUPAC name is N-[[2-(4-methoxyphenoxy)-4-pyridinyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride.
| Compound Name | N-[[2-(4-methoxyphenoxy)-4-pyridinyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119847897 |
| Molecular Formula | C22H29Cl2N3O3 |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | N-[[2-(4-methoxyphenoxy)-4-pyridinyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
| SMILES | COc1ccc(Oc2cc(CNC(=O)C3CC4CCCCC4N3)ccn2)cc1.Cl.Cl |
| InChI | InChI=1S/C22H27N3O3.2ClH/c1-27-17-6-8-18(9-7-17)28-21-12-15(10-11-23-21)14-24-22(26)20-13-16-4-2-3-5-19(16)25-20;;/h6-12,16,19-20,25H,2-5,13-14H2,1H3,(H,24,26);2*1H |
| InChIKey | AMZYAHWTSWTTNI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |